C20H22ClNO3 — CID 22686794
3-chloro-5-ethoxy-4-[2-(2,3,6-trimethylphenoxy)ethoxy]benzonitrile (PubChem CID 22686794) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-4-[2-(2,3,6-trimethylphenoxy)ethoxy]benzonitrile.
| Compound Name | 3-chloro-5-ethoxy-4-[2-(2,3,6-trimethylphenoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 22686794 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-chloro-5-ethoxy-4-[2-(2,3,6-trimethylphenoxy)ethoxy]benzonitrile |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OCCOc1c(C)ccc(C)c1C |
| InChI | InChI=1S/C20H22ClNO3/c1-5-23-18-11-16(12-22)10-17(21)20(18)25-9-8-24-19-14(3)7-6-13(2)15(19)4/h6-7,10-11H,5,8-9H2,1-4H3 |
| InChIKey | YVTJAGANDCEHLZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|