C18H19NO2 — CID 20990076
4-[2-(2,3,6-trimethylphenoxy)ethoxy]benzonitrile (PubChem CID 20990076) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-[2-(2,3,6-trimethylphenoxy)ethoxy]benzonitrile.
| Compound Name | 4-[2-(2,3,6-trimethylphenoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 20990076 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-[2-(2,3,6-trimethylphenoxy)ethoxy]benzonitrile |
| SMILES | Cc1ccc(C)c(OCCOc2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C18H19NO2/c1-13-4-5-14(2)18(15(13)3)21-11-10-20-17-8-6-16(12-19)7-9-17/h4-9H,10-11H2,1-3H3 |
| InChIKey | HWDKPPVQRKPPNS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|