C17H17NO4 — CID 51142108
4-[2-(2,6-dimethoxyphenoxy)ethoxy]benzonitrile (PubChem CID 51142108) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-[2-(2,6-dimethoxyphenoxy)ethoxy]benzonitrile.
| Compound Name | 4-[2-(2,6-dimethoxyphenoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 51142108 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[2-(2,6-dimethoxyphenoxy)ethoxy]benzonitrile |
| SMILES | COc1cccc(OC)c1OCCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-19-15-4-3-5-16(20-2)17(15)22-11-10-21-14-8-6-13(12-18)7-9-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | ZGGMAKMLUBYSBP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|