C17H21NO4 — CID 39427302
5-[2-(2,6-dimethoxyphenoxy)ethoxy]-2-methylaniline (PubChem CID 39427302) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-[2-(2,6-dimethoxyphenoxy)ethoxy]-2-methylaniline.
| Compound Name | 5-[2-(2,6-dimethoxyphenoxy)ethoxy]-2-methylaniline |
|---|---|
| PubChem CID | 39427302 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-[2-(2,6-dimethoxyphenoxy)ethoxy]-2-methylaniline |
| SMILES | COc1cccc(OC)c1OCCOc1ccc(C)c(N)c1 |
| InChI | InChI=1S/C17H21NO4/c1-12-7-8-13(11-14(12)18)21-9-10-22-17-15(19-2)5-4-6-16(17)20-3/h4-8,11H,9-10,18H2,1-3H3 |
| InChIKey | CGEHBDCIAFIUSI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|