C11H17NO3 — CID 14025832
3-(2,6-dimethoxyphenoxy)propan-1-amine (PubChem CID 14025832) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenoxy)propan-1-amine.
| Compound Name | 3-(2,6-dimethoxyphenoxy)propan-1-amine |
|---|---|
| PubChem CID | 14025832 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-(2,6-dimethoxyphenoxy)propan-1-amine |
| SMILES | COc1cccc(OC)c1OCCCN |
| InChI | InChI=1S/C11H17NO3/c1-13-9-5-3-6-10(14-2)11(9)15-8-4-7-12/h3,5-6H,4,7-8,12H2,1-2H3 |
| InChIKey | ZPQXWUOJHSFONL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|