C13H18O4 — CID 43793515
5-(2,6-dimethoxyphenoxy)pentan-2-one (PubChem CID 43793515) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 5-(2,6-dimethoxyphenoxy)pentan-2-one.
| Compound Name | 5-(2,6-dimethoxyphenoxy)pentan-2-one |
|---|---|
| PubChem CID | 43793515 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 5-(2,6-dimethoxyphenoxy)pentan-2-one |
| SMILES | COc1cccc(OC)c1OCCCC(C)=O |
| InChI | InChI=1S/C13H18O4/c1-10(14)6-5-9-17-13-11(15-2)7-4-8-12(13)16-3/h4,7-8H,5-6,9H2,1-3H3 |
| InChIKey | WAVRRBHUECPQLW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|