C12H17NO3S — CID 24696993
4-(2,6-dimethoxyphenoxy)butanethioamide (PubChem CID 24696993) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenoxy)butanethioamide.
| Compound Name | 4-(2,6-dimethoxyphenoxy)butanethioamide |
|---|---|
| PubChem CID | 24696993 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-(2,6-dimethoxyphenoxy)butanethioamide |
| SMILES | COc1cccc(OC)c1OCCCC(N)=S |
| InChI | InChI=1S/C12H17NO3S/c1-14-9-5-3-6-10(15-2)12(9)16-8-4-7-11(13)17/h3,5-6H,4,7-8H2,1-2H3,(H2,13,17) |
| InChIKey | BDFGWZJRWJWHNY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|