C15H25NO4 — CID 106810424
2-amino-5-(2,6-dimethoxyphenoxy)-2-ethylpentan-1-ol (PubChem CID 106810424) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-amino-5-(2,6-dimethoxyphenoxy)-2-ethylpentan-1-ol.
| Compound Name | 2-amino-5-(2,6-dimethoxyphenoxy)-2-ethylpentan-1-ol |
|---|---|
| PubChem CID | 106810424 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-amino-5-(2,6-dimethoxyphenoxy)-2-ethylpentan-1-ol |
| SMILES | CCC(N)(CO)CCCOc1c(OC)cccc1OC |
| InChI | InChI=1S/C15H25NO4/c1-4-15(16,11-17)9-6-10-20-14-12(18-2)7-5-8-13(14)19-3/h5,7-8,17H,4,6,9-11,16H2,1-3H3 |
| InChIKey | ZMTAKLUAIMBARD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|