C16H27NO4 — CID 64803042
4-(2,6-dimethoxyphenoxy)-2-methyl-2-(propylamino)butan-1-ol (PubChem CID 64803042) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenoxy)-2-methyl-2-(propylamino)butan-1-ol.
| Compound Name | 4-(2,6-dimethoxyphenoxy)-2-methyl-2-(propylamino)butan-1-ol |
|---|---|
| PubChem CID | 64803042 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-(2,6-dimethoxyphenoxy)-2-methyl-2-(propylamino)butan-1-ol |
| SMILES | CCCNC(C)(CO)CCOc1c(OC)cccc1OC |
| InChI | InChI=1S/C16H27NO4/c1-5-10-17-16(2,12-18)9-11-21-15-13(19-3)7-6-8-14(15)20-4/h6-8,17-18H,5,9-12H2,1-4H3 |
| InChIKey | AGMKPTAWSWVZFK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |