C14H23NO4 — CID 62572083
N-[2-(2,6-dimethoxyphenoxy)ethyl]-3-methoxypropan-1-amine (PubChem CID 62572083) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is N-[2-(2,6-dimethoxyphenoxy)ethyl]-3-methoxypropan-1-amine.
| Compound Name | N-[2-(2,6-dimethoxyphenoxy)ethyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 62572083 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-[2-(2,6-dimethoxyphenoxy)ethyl]-3-methoxypropan-1-amine |
| SMILES | COCCCNCCOc1c(OC)cccc1OC |
| InChI | InChI=1S/C14H23NO4/c1-16-10-5-8-15-9-11-19-14-12(17-2)6-4-7-13(14)18-3/h4,6-7,15H,5,8-11H2,1-3H3 |
| InChIKey | GCKGFSWYKAUUPF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|