C13H21NO4 — CID 39260375
2-[3-(2,3-dimethoxyphenoxy)propylamino]ethanol (PubChem CID 39260375) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-[3-(2,3-dimethoxyphenoxy)propylamino]ethanol.
| Compound Name | 2-[3-(2,3-dimethoxyphenoxy)propylamino]ethanol |
|---|---|
| PubChem CID | 39260375 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[3-(2,3-dimethoxyphenoxy)propylamino]ethanol |
| SMILES | COc1cccc(OCCCNCCO)c1OC |
| InChI | InChI=1S/C13H21NO4/c1-16-11-5-3-6-12(13(11)17-2)18-10-4-7-14-8-9-15/h3,5-6,14-15H,4,7-10H2,1-2H3 |
| InChIKey | JLXVHFGKWRRYME-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|