C11H15Cl3NO2- — CID 71297106
2-[3-(2,3-dichlorophenoxy)propylamino]ethanol chloride (PubChem CID 71297106) has the molecular formula C11H15Cl3NO2- and a molecular weight of 299.60 g/mol. Its IUPAC name is 2-[3-(2,3-dichlorophenoxy)propylamino]ethanol chloride.
| Compound Name | 2-[3-(2,3-dichlorophenoxy)propylamino]ethanol chloride |
|---|---|
| PubChem CID | 71297106 |
| Molecular Formula | C11H15Cl3NO2- |
| Molecular Weight | 299.60 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-[3-(2,3-dichlorophenoxy)propylamino]ethanol chloride |
| SMILES | OCCNCCCOc1cccc(Cl)c1Cl.[Cl-] |
| InChI | InChI=1S/C11H15Cl2NO2.ClH/c12-9-3-1-4-10(11(9)13)16-8-2-5-14-6-7-15;/h1,3-4,14-15H,2,5-8H2;1H/p-1 |
| InChIKey | GFCJFYSIPRIHKT-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.60 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|