C9H12Cl2N4O — CID 95469367
2-[2-(2,3-dichlorophenoxy)ethylamino]guanidine (PubChem CID 95469367) has the molecular formula C9H12Cl2N4O and a molecular weight of 263.13 g/mol. Its IUPAC name is 2-[2-(2,3-dichlorophenoxy)ethylamino]guanidine.
| Compound Name | 2-[2-(2,3-dichlorophenoxy)ethylamino]guanidine |
|---|---|
| PubChem CID | 95469367 |
| Molecular Formula | C9H12Cl2N4O |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-[2-(2,3-dichlorophenoxy)ethylamino]guanidine |
| SMILES | NC(N)=NNCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H12Cl2N4O/c10-6-2-1-3-7(8(6)11)16-5-4-14-15-9(12)13/h1-3,14H,4-5H2,(H4,12,13,15) |
| InChIKey | ANIWOZNJRAHSBZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|