C10H10Cl2F3NO — CID 62599216
N-[2-(2,3-dichlorophenoxy)ethyl]-2,2,2-trifluoroethanamine (PubChem CID 62599216) has the molecular formula C10H10Cl2F3NO and a molecular weight of 288.10 g/mol. Its IUPAC name is N-[2-(2,3-dichlorophenoxy)ethyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[2-(2,3-dichlorophenoxy)ethyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 62599216 |
| Molecular Formula | C10H10Cl2F3NO |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | N-[2-(2,3-dichlorophenoxy)ethyl]-2,2,2-trifluoroethanamine |
| SMILES | FC(F)(F)CNCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl2F3NO/c11-7-2-1-3-8(9(7)12)17-5-4-16-6-10(13,14)15/h1-3,16H,4-6H2 |
| InChIKey | ORUZKXVSAOKIKX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|