C10H10Br2F3NO — CID 62597022
N-[2-(2,4-dibromophenoxy)ethyl]-2,2,2-trifluoroethanamine (PubChem CID 62597022) has the molecular formula C10H10Br2F3NO and a molecular weight of 377.00 g/mol. Its IUPAC name is N-[2-(2,4-dibromophenoxy)ethyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[2-(2,4-dibromophenoxy)ethyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 62597022 |
| Molecular Formula | C10H10Br2F3NO |
| Molecular Weight | 377.00 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | N-[2-(2,4-dibromophenoxy)ethyl]-2,2,2-trifluoroethanamine |
| SMILES | FC(F)(F)CNCCOc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H10Br2F3NO/c11-7-1-2-9(8(12)5-7)17-4-3-16-6-10(13,14)15/h1-2,5,16H,3-4,6H2 |
| InChIKey | XJJZILKPJKHYBA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.00 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|