C11H11Br2NO — CID 62597194
N-[2-(2,4-dibromophenoxy)ethyl]prop-2-yn-1-amine (PubChem CID 62597194) has the molecular formula C11H11Br2NO and a molecular weight of 333.02 g/mol. Its IUPAC name is N-[2-(2,4-dibromophenoxy)ethyl]prop-2-yn-1-amine.
| Compound Name | N-[2-(2,4-dibromophenoxy)ethyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 62597194 |
| Molecular Formula | C11H11Br2NO |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | N-[2-(2,4-dibromophenoxy)ethyl]prop-2-yn-1-amine |
| SMILES | C#CCNCCOc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H11Br2NO/c1-2-5-14-6-7-15-11-4-3-9(12)8-10(11)13/h1,3-4,8,14H,5-7H2 |
| InChIKey | NASBKSUCYQWQNR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|