C11H15Br2NO — CID 62597711
N-[2-(2,4-dibromophenoxy)ethyl]propan-2-amine (PubChem CID 62597711) has the molecular formula C11H15Br2NO and a molecular weight of 337.06 g/mol. Its IUPAC name is N-[2-(2,4-dibromophenoxy)ethyl]propan-2-amine.
| Compound Name | N-[2-(2,4-dibromophenoxy)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 62597711 |
| Molecular Formula | C11H15Br2NO |
| Molecular Weight | 337.06 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | N-[2-(2,4-dibromophenoxy)ethyl]propan-2-amine |
| SMILES | CC(C)NCCOc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H15Br2NO/c1-8(2)14-5-6-15-11-4-3-9(12)7-10(11)13/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | AIPJJGAQMUEJEU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.06 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|