C14H10Br4O2 — CID 59907339
1,4-dibromo-2-[2-(2,4-dibromophenoxy)ethoxy]benzene (PubChem CID 59907339) has the molecular formula C14H10Br4O2 and a molecular weight of 529.85 g/mol. Its IUPAC name is 1,4-dibromo-2-[2-(2,4-dibromophenoxy)ethoxy]benzene.
| Compound Name | 1,4-dibromo-2-[2-(2,4-dibromophenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 59907339 |
| Molecular Formula | C14H10Br4O2 |
| Molecular Weight | 529.85 g/mol |
| Exact Mass | 525.74 |
| IUPAC Name | 1,4-dibromo-2-[2-(2,4-dibromophenoxy)ethoxy]benzene |
| SMILES | Brc1ccc(OCCOc2cc(Br)ccc2Br)c(Br)c1 |
| InChI | InChI=1S/C14H10Br4O2/c15-9-2-4-13(12(18)7-9)19-5-6-20-14-8-10(16)1-3-11(14)17/h1-4,7-8H,5-6H2 |
| InChIKey | SAZZBOHPHPPCBD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.85 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|