C12H6Br4O — CID 15509892
1,4-dibromo-2-(2,4-dibromophenoxy)benzene (PubChem CID 15509892) has the molecular formula C12H6Br4O and a molecular weight of 485.80 g/mol. Its IUPAC name is 1,4-dibromo-2-(2,4-dibromophenoxy)benzene.
| Compound Name | 1,4-dibromo-2-(2,4-dibromophenoxy)benzene |
|---|---|
| PubChem CID | 15509892 |
| Molecular Formula | C12H6Br4O |
| Molecular Weight | 485.80 g/mol |
| Exact Mass | 481.72 |
| IUPAC Name | 1,4-dibromo-2-(2,4-dibromophenoxy)benzene |
| SMILES | Brc1ccc(Oc2cc(Br)ccc2Br)c(Br)c1 |
| InChI | InChI=1S/C12H6Br4O/c13-7-2-4-11(10(16)5-7)17-12-6-8(14)1-3-9(12)15/h1-6H |
| InChIKey | QWVDUBDYUPHNHY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.80 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |