C12H7Br3O2 — CID 11015373
2-bromo-5-(2,4-dibromophenoxy)phenol (PubChem CID 11015373) has the molecular formula C12H7Br3O2 and a molecular weight of 422.90 g/mol. Its IUPAC name is 2-bromo-5-(2,4-dibromophenoxy)phenol.
| Compound Name | 2-bromo-5-(2,4-dibromophenoxy)phenol |
|---|---|
| PubChem CID | 11015373 |
| Molecular Formula | C12H7Br3O2 |
| Molecular Weight | 422.90 g/mol |
| Exact Mass | 419.80 |
| IUPAC Name | 2-bromo-5-(2,4-dibromophenoxy)phenol |
| SMILES | Oc1cc(Oc2ccc(Br)cc2Br)ccc1Br |
| InChI | InChI=1S/C12H7Br3O2/c13-7-1-4-12(10(15)5-7)17-8-2-3-9(14)11(16)6-8/h1-6,16H |
| InChIKey | NATAVEHSIYVLEC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |