C12H6Br4O3 — CID 102140384
3,5-dibromo-2-(2,4-dibromophenoxy)benzene-1,4-diol (PubChem CID 102140384) has the molecular formula C12H6Br4O3 and a molecular weight of 517.79 g/mol. Its IUPAC name is 3,5-dibromo-2-(2,4-dibromophenoxy)benzene-1,4-diol.
| Compound Name | 3,5-dibromo-2-(2,4-dibromophenoxy)benzene-1,4-diol |
|---|---|
| PubChem CID | 102140384 |
| Molecular Formula | C12H6Br4O3 |
| Molecular Weight | 517.79 g/mol |
| Exact Mass | 513.71 |
| IUPAC Name | 3,5-dibromo-2-(2,4-dibromophenoxy)benzene-1,4-diol |
| SMILES | Oc1cc(Br)c(O)c(Br)c1Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H6Br4O3/c13-5-1-2-9(6(14)3-5)19-12-8(17)4-7(15)11(18)10(12)16/h1-4,17-18H |
| InChIKey | BDEHRCSSFGDNCW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.79 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|