C12H5Br5O — CID 86208553
1,2,3-tribromo-5-(2,4-dibromophenoxy)benzene (PubChem CID 86208553) has the molecular formula C12H5Br5O and a molecular weight of 564.69 g/mol. Its IUPAC name is 1,2,3-tribromo-5-(2,4-dibromophenoxy)benzene.
| Compound Name | 1,2,3-tribromo-5-(2,4-dibromophenoxy)benzene |
|---|---|
| PubChem CID | 86208553 |
| Molecular Formula | C12H5Br5O |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 559.63 |
| IUPAC Name | 1,2,3-tribromo-5-(2,4-dibromophenoxy)benzene |
| SMILES | Brc1ccc(Oc2cc(Br)c(Br)c(Br)c2)c(Br)c1 |
| InChI | InChI=1S/C12H5Br5O/c13-6-1-2-11(8(14)3-6)18-7-4-9(15)12(17)10(16)5-7/h1-5H |
| InChIKey | SBKMUEQNZNDYFW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|