C13H8Br4O — CID 114062644
2,4-dibromo-1-[2-bromo-4-(bromomethyl)phenoxy]benzene (PubChem CID 114062644) has the molecular formula C13H8Br4O and a molecular weight of 499.82 g/mol. Its IUPAC name is 2,4-dibromo-1-[2-bromo-4-(bromomethyl)phenoxy]benzene.
| Compound Name | 2,4-dibromo-1-[2-bromo-4-(bromomethyl)phenoxy]benzene |
|---|---|
| PubChem CID | 114062644 |
| Molecular Formula | C13H8Br4O |
| Molecular Weight | 499.82 g/mol |
| Exact Mass | 495.73 |
| IUPAC Name | 2,4-dibromo-1-[2-bromo-4-(bromomethyl)phenoxy]benzene |
| SMILES | BrCc1ccc(Oc2ccc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C13H8Br4O/c14-7-8-1-3-12(10(16)5-8)18-13-4-2-9(15)6-11(13)17/h1-6H,7H2 |
| InChIKey | UZDKGOQOZVWEIA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.82 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|