C14H13Br2NO — CID 64720895
1-[4-(2,4-dibromophenoxy)phenyl]-N-methylmethanamine (PubChem CID 64720895) has the molecular formula C14H13Br2NO and a molecular weight of 371.07 g/mol. Its IUPAC name is 1-[4-(2,4-dibromophenoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[4-(2,4-dibromophenoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 64720895 |
| Molecular Formula | C14H13Br2NO |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 1-[4-(2,4-dibromophenoxy)phenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(Oc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C14H13Br2NO/c1-17-9-10-2-5-12(6-3-10)18-14-7-4-11(15)8-13(14)16/h2-8,17H,9H2,1H3 |
| InChIKey | UDAREESZSWIYMA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |