C13H10Br2O2 — CID 64720453
[4-(2,4-dibromophenoxy)phenyl]methanol (PubChem CID 64720453) has the molecular formula C13H10Br2O2 and a molecular weight of 358.03 g/mol. Its IUPAC name is [4-(2,4-dibromophenoxy)phenyl]methanol.
| Compound Name | [4-(2,4-dibromophenoxy)phenyl]methanol |
|---|---|
| PubChem CID | 64720453 |
| Molecular Formula | C13H10Br2O2 |
| Molecular Weight | 358.03 g/mol |
| Exact Mass | 355.90 |
| IUPAC Name | [4-(2,4-dibromophenoxy)phenyl]methanol |
| SMILES | OCc1ccc(Oc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C13H10Br2O2/c14-10-3-6-13(12(15)7-10)17-11-4-1-9(8-16)2-5-11/h1-7,16H,8H2 |
| InChIKey | DLXVNYYXXFSFIA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.03 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |