C14H12Br2O3 — CID 79403220
[4-(2,5-dibromo-4-methoxyphenoxy)phenyl]methanol (PubChem CID 79403220) has the molecular formula C14H12Br2O3 and a molecular weight of 388.06 g/mol. Its IUPAC name is [4-(2,5-dibromo-4-methoxyphenoxy)phenyl]methanol.
| Compound Name | [4-(2,5-dibromo-4-methoxyphenoxy)phenyl]methanol |
|---|---|
| PubChem CID | 79403220 |
| Molecular Formula | C14H12Br2O3 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.92 |
| IUPAC Name | [4-(2,5-dibromo-4-methoxyphenoxy)phenyl]methanol |
| SMILES | COc1cc(Br)c(Oc2ccc(CO)cc2)cc1Br |
| InChI | InChI=1S/C14H12Br2O3/c1-18-13-6-12(16)14(7-11(13)15)19-10-4-2-9(8-17)3-5-10/h2-7,17H,8H2,1H3 |
| InChIKey | ROFHVRDRAUACTF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |