C15H15Br2NO2 — CID 59165138
4-(2,5-dibromo-4-methoxyphenoxy)-N,N-dimethylaniline (PubChem CID 59165138) has the molecular formula C15H15Br2NO2 and a molecular weight of 401.10 g/mol. Its IUPAC name is 4-(2,5-dibromo-4-methoxyphenoxy)-N,N-dimethylaniline.
| Compound Name | 4-(2,5-dibromo-4-methoxyphenoxy)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59165138 |
| Molecular Formula | C15H15Br2NO2 |
| Molecular Weight | 401.10 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 4-(2,5-dibromo-4-methoxyphenoxy)-N,N-dimethylaniline |
| SMILES | COc1cc(Br)c(Oc2ccc(N(C)C)cc2)cc1Br |
| InChI | InChI=1S/C15H15Br2NO2/c1-18(2)10-4-6-11(7-5-10)20-15-9-12(16)14(19-3)8-13(15)17/h4-9H,1-3H3 |
| InChIKey | SMKJHSKHAGEOHP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.10 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |