C16H19BrN2O4S — CID 78809657
2-bromo-N-[4-(dimethylamino)phenyl]-4,5-dimethoxybenzenesulfonamide (PubChem CID 78809657) has the molecular formula C16H19BrN2O4S and a molecular weight of 415.31 g/mol. Its IUPAC name is 2-bromo-N-[4-(dimethylamino)phenyl]-4,5-dimethoxybenzenesulfonamide.
| Compound Name | 2-bromo-N-[4-(dimethylamino)phenyl]-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 78809657 |
| Molecular Formula | C16H19BrN2O4S |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-bromo-N-[4-(dimethylamino)phenyl]-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)Nc2ccc(N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C16H19BrN2O4S/c1-19(2)12-7-5-11(6-8-12)18-24(20,21)16-10-15(23-4)14(22-3)9-13(16)17/h5-10,18H,1-4H3 |
| InChIKey | VFWNMOCCXUQRNL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|