C14H12BrCl2NO4S — CID 112773648
2-bromo-N-(2,6-dichlorophenyl)-4,5-dimethoxybenzenesulfonamide (PubChem CID 112773648) has the molecular formula C14H12BrCl2NO4S and a molecular weight of 441.13 g/mol. Its IUPAC name is 2-bromo-N-(2,6-dichlorophenyl)-4,5-dimethoxybenzenesulfonamide.
| Compound Name | 2-bromo-N-(2,6-dichlorophenyl)-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 112773648 |
| Molecular Formula | C14H12BrCl2NO4S |
| Molecular Weight | 441.13 g/mol |
| Exact Mass | 438.90 |
| IUPAC Name | 2-bromo-N-(2,6-dichlorophenyl)-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)Nc2c(Cl)cccc2Cl)cc1OC |
| InChI | InChI=1S/C14H12BrCl2NO4S/c1-21-11-6-8(15)13(7-12(11)22-2)23(19,20)18-14-9(16)4-3-5-10(14)17/h3-7,18H,1-2H3 |
| InChIKey | UELYEXSCHRGSNH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.13 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |