C16H18BrNO5S — CID 27658176
2-bromo-N-(2-ethoxyphenyl)-4,5-dimethoxybenzenesulfonamide (PubChem CID 27658176) has the molecular formula C16H18BrNO5S and a molecular weight of 416.29 g/mol. Its IUPAC name is 2-bromo-N-(2-ethoxyphenyl)-4,5-dimethoxybenzenesulfonamide.
| Compound Name | 2-bromo-N-(2-ethoxyphenyl)-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 27658176 |
| Molecular Formula | C16H18BrNO5S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 2-bromo-N-(2-ethoxyphenyl)-4,5-dimethoxybenzenesulfonamide |
| SMILES | CCOc1ccccc1NS(=O)(=O)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C16H18BrNO5S/c1-4-23-13-8-6-5-7-12(13)18-24(19,20)16-10-15(22-3)14(21-2)9-11(16)17/h5-10,18H,4H2,1-3H3 |
| InChIKey | KJHSUIYPZYVXEF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |