C17H15BrN2O4S — CID 112773656
2-bromo-4,5-dimethoxy-N-quinolin-5-ylbenzenesulfonamide (PubChem CID 112773656) has the molecular formula C17H15BrN2O4S and a molecular weight of 423.29 g/mol. Its IUPAC name is 2-bromo-4,5-dimethoxy-N-quinolin-5-ylbenzenesulfonamide.
| Compound Name | 2-bromo-4,5-dimethoxy-N-quinolin-5-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 112773656 |
| Molecular Formula | C17H15BrN2O4S |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2-bromo-4,5-dimethoxy-N-quinolin-5-ylbenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)Nc2cccc3ncccc23)cc1OC |
| InChI | InChI=1S/C17H15BrN2O4S/c1-23-15-9-12(18)17(10-16(15)24-2)25(21,22)20-14-7-3-6-13-11(14)5-4-8-19-13/h3-10,20H,1-2H3 |
| InChIKey | RCNFIUDMAKKCEO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |