C18H14BrN3O2S — CID 4027215
3-bromo-4-methoxy-N-(quinolin-5-ylcarbamothioyl)benzamide (PubChem CID 4027215) has the molecular formula C18H14BrN3O2S and a molecular weight of 416.30 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-(quinolin-5-ylcarbamothioyl)benzamide.
| Compound Name | 3-bromo-4-methoxy-N-(quinolin-5-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 4027215 |
| Molecular Formula | C18H14BrN3O2S |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 3-bromo-4-methoxy-N-(quinolin-5-ylcarbamothioyl)benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cccc3ncccc23)cc1Br |
| InChI | InChI=1S/C18H14BrN3O2S/c1-24-16-8-7-11(10-13(16)19)17(23)22-18(25)21-15-6-2-5-14-12(15)4-3-9-20-14/h2-10H,1H3,(H2,21,22,23,25) |
| InChIKey | PRJDCMGCKQEWGY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|