C17H11Cl2N3OS — CID 3965193
3,4-dichloro-N-(quinolin-5-ylcarbamothioyl)benzamide (PubChem CID 3965193) has the molecular formula C17H11Cl2N3OS and a molecular weight of 376.27 g/mol. Its IUPAC name is 3,4-dichloro-N-(quinolin-5-ylcarbamothioyl)benzamide.
| Compound Name | 3,4-dichloro-N-(quinolin-5-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 3965193 |
| Molecular Formula | C17H11Cl2N3OS |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 3,4-dichloro-N-(quinolin-5-ylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)Nc1cccc2ncccc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2N3OS/c18-12-7-6-10(9-13(12)19)16(23)22-17(24)21-15-5-1-4-14-11(15)3-2-8-20-14/h1-9H,(H2,21,22,23,24) |
| InChIKey | QHONYJNRTBLRGA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|