C17H16N2O4S — CID 3866922
N-(2,3-dimethoxyphenyl)quinoline-8-sulfonamide (PubChem CID 3866922) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is N-(2,3-dimethoxyphenyl)quinoline-8-sulfonamide.
| Compound Name | N-(2,3-dimethoxyphenyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 3866922 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-(2,3-dimethoxyphenyl)quinoline-8-sulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2cccc3cccnc23)c1OC |
| InChI | InChI=1S/C17H16N2O4S/c1-22-14-9-4-8-13(17(14)23-2)19-24(20,21)15-10-3-6-12-7-5-11-18-16(12)15/h3-11,19H,1-2H3 |
| InChIKey | NFEQTXWSYWJYMO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |