C24H23N5O4S — CID 129042497
N-[2-(2-methoxyanilino)ethyl]-6-(quinolin-8-ylsulfonylamino)pyridine-3-carboxamide (PubChem CID 129042497) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[2-(2-methoxyanilino)ethyl]-6-(quinolin-8-ylsulfonylamino)pyridine-3-carboxamide.
| Compound Name | N-[2-(2-methoxyanilino)ethyl]-6-(quinolin-8-ylsulfonylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129042497 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[2-(2-methoxyanilino)ethyl]-6-(quinolin-8-ylsulfonylamino)pyridine-3-carboxamide |
| SMILES | COc1ccccc1NCCNC(=O)c1ccc(NS(=O)(=O)c2cccc3cccnc23)nc1 |
| InChI | InChI=1S/C24H23N5O4S/c1-33-20-9-3-2-8-19(20)25-14-15-27-24(30)18-11-12-22(28-16-18)29-34(31,32)21-10-4-6-17-7-5-13-26-23(17)21/h2-13,16,25H,14-15H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | JIBAHNGADABFLT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|