C20H22N2O2S — CID 3847613
2,3,4,5,6-pentamethyl-N-quinolin-5-ylbenzenesulfonamide (PubChem CID 3847613) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-quinolin-5-ylbenzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-quinolin-5-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 3847613 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-quinolin-5-ylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)Nc2cccc3ncccc23)c(C)c1C |
| InChI | InChI=1S/C20H22N2O2S/c1-12-13(2)15(4)20(16(5)14(12)3)25(23,24)22-19-10-6-9-18-17(19)8-7-11-21-18/h6-11,22H,1-5H3 |
| InChIKey | VKKIHLGFDLSACG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |