C13H10ClN3O2S2 — CID 43456143
2-chloro-4-methyl-N-quinolin-5-yl-1,3-thiazole-5-sulfonamide (PubChem CID 43456143) has the molecular formula C13H10ClN3O2S2 and a molecular weight of 339.83 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-quinolin-5-yl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-4-methyl-N-quinolin-5-yl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43456143 |
| Molecular Formula | C13H10ClN3O2S2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 2-chloro-4-methyl-N-quinolin-5-yl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C13H10ClN3O2S2/c1-8-12(20-13(14)16-8)21(18,19)17-11-6-2-5-10-9(11)4-3-7-15-10/h2-7,17H,1H3 |
| InChIKey | SKVWGLGXMSKNNX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |