C13H10Cl3NO3S — CID 113098935
3-chloro-N-(2,6-dichlorophenyl)-4-methoxybenzenesulfonamide (PubChem CID 113098935) has the molecular formula C13H10Cl3NO3S and a molecular weight of 366.65 g/mol. Its IUPAC name is 3-chloro-N-(2,6-dichlorophenyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(2,6-dichlorophenyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113098935 |
| Molecular Formula | C13H10Cl3NO3S |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 3-chloro-N-(2,6-dichlorophenyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3NO3S/c1-20-12-6-5-8(7-11(12)16)21(18,19)17-13-9(14)3-2-4-10(13)15/h2-7,17H,1H3 |
| InChIKey | KSHDKWYPAMFGEL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |