C17H20ClNO3S — CID 113098500
3-chloro-N-(2,6-diethylphenyl)-4-methoxybenzenesulfonamide (PubChem CID 113098500) has the molecular formula C17H20ClNO3S and a molecular weight of 353.87 g/mol. Its IUPAC name is 3-chloro-N-(2,6-diethylphenyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(2,6-diethylphenyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113098500 |
| Molecular Formula | C17H20ClNO3S |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3-chloro-N-(2,6-diethylphenyl)-4-methoxybenzenesulfonamide |
| SMILES | CCc1cccc(CC)c1NS(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClNO3S/c1-4-12-7-6-8-13(5-2)17(12)19-23(20,21)14-9-10-16(22-3)15(18)11-14/h6-11,19H,4-5H2,1-3H3 |
| InChIKey | BQZSPPYNEGODLG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |