C13H21ClN2O3S — CID 63888398
N-[3-(aminomethyl)pentan-3-yl]-3-chloro-4-methoxybenzenesulfonamide (PubChem CID 63888398) has the molecular formula C13H21ClN2O3S and a molecular weight of 320.84 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-chloro-4-methoxybenzenesulfonamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-chloro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 63888398 |
| Molecular Formula | C13H21ClN2O3S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-chloro-4-methoxybenzenesulfonamide |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C13H21ClN2O3S/c1-4-13(5-2,9-15)16-20(17,18)10-6-7-12(19-3)11(14)8-10/h6-8,16H,4-5,9,15H2,1-3H3 |
| InChIKey | VXKBSGKFRNONSY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |