C15H16ClNO5S2 — CID 39829723
3-chloro-N-(4-ethylsulfonylphenyl)-4-methoxybenzenesulfonamide (PubChem CID 39829723) has the molecular formula C15H16ClNO5S2 and a molecular weight of 389.88 g/mol. Its IUPAC name is 3-chloro-N-(4-ethylsulfonylphenyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(4-ethylsulfonylphenyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 39829723 |
| Molecular Formula | C15H16ClNO5S2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 3-chloro-N-(4-ethylsulfonylphenyl)-4-methoxybenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H16ClNO5S2/c1-3-23(18,19)12-6-4-11(5-7-12)17-24(20,21)13-8-9-15(22-2)14(16)10-13/h4-10,17H,3H2,1-2H3 |
| InChIKey | UCOUQQIIXDKQPE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |