C16H19NO2 — CID 156755643
4-(4-methoxyphenoxy)-N,N,3-trimethylaniline (PubChem CID 156755643) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N,N,3-trimethylaniline.
| Compound Name | 4-(4-methoxyphenoxy)-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 156755643 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N,N,3-trimethylaniline |
| SMILES | COc1ccc(Oc2ccc(N(C)C)cc2C)cc1 |
| InChI | InChI=1S/C16H19NO2/c1-12-11-13(17(2)3)5-10-16(12)19-15-8-6-14(18-4)7-9-15/h5-11H,1-4H3 |
| InChIKey | ANLCCNKUGSIKQC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |