C15H16FNO — CID 156755640
4-(4-fluorophenoxy)-N,N,3-trimethylaniline (PubChem CID 156755640) has the molecular formula C15H16FNO and a molecular weight of 245.30 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N,N,3-trimethylaniline.
| Compound Name | 4-(4-fluorophenoxy)-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 156755640 |
| Molecular Formula | C15H16FNO |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-(4-fluorophenoxy)-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FNO/c1-11-10-13(17(2)3)6-9-15(11)18-14-7-4-12(16)5-8-14/h4-10H,1-3H3 |
| InChIKey | VTCMAEYUBGSWRO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |