C13H9Br2FO2 — CID 64720660
[4-(2,4-dibromophenoxy)-3-fluorophenyl]methanol (PubChem CID 64720660) has the molecular formula C13H9Br2FO2 and a molecular weight of 376.02 g/mol. Its IUPAC name is [4-(2,4-dibromophenoxy)-3-fluorophenyl]methanol.
| Compound Name | [4-(2,4-dibromophenoxy)-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 64720660 |
| Molecular Formula | C13H9Br2FO2 |
| Molecular Weight | 376.02 g/mol |
| Exact Mass | 373.90 |
| IUPAC Name | [4-(2,4-dibromophenoxy)-3-fluorophenyl]methanol |
| SMILES | OCc1ccc(Oc2ccc(Br)cc2Br)c(F)c1 |
| InChI | InChI=1S/C13H9Br2FO2/c14-9-2-4-12(10(15)6-9)18-13-3-1-8(7-17)5-11(13)16/h1-6,17H,7H2 |
| InChIKey | CGGQGWSTHFWDNZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |