C13H9F3O2 — CID 55112239
[4-(3,5-difluorophenoxy)-3-fluorophenyl]methanol (PubChem CID 55112239) has the molecular formula C13H9F3O2 and a molecular weight of 254.21 g/mol. Its IUPAC name is [4-(3,5-difluorophenoxy)-3-fluorophenyl]methanol.
| Compound Name | [4-(3,5-difluorophenoxy)-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 55112239 |
| Molecular Formula | C13H9F3O2 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | [4-(3,5-difluorophenoxy)-3-fluorophenyl]methanol |
| SMILES | OCc1ccc(Oc2cc(F)cc(F)c2)c(F)c1 |
| InChI | InChI=1S/C13H9F3O2/c14-9-4-10(15)6-11(5-9)18-13-2-1-8(7-17)3-12(13)16/h1-6,17H,7H2 |
| InChIKey | NPMXWWSUHSLFDX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |