C13H9Br2F2NO — CID 64720890
[4-(2,4-dibromophenoxy)-3,5-difluorophenyl]methanamine (PubChem CID 64720890) has the molecular formula C13H9Br2F2NO and a molecular weight of 393.03 g/mol. Its IUPAC name is [4-(2,4-dibromophenoxy)-3,5-difluorophenyl]methanamine.
| Compound Name | [4-(2,4-dibromophenoxy)-3,5-difluorophenyl]methanamine |
|---|---|
| PubChem CID | 64720890 |
| Molecular Formula | C13H9Br2F2NO |
| Molecular Weight | 393.03 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | [4-(2,4-dibromophenoxy)-3,5-difluorophenyl]methanamine |
| SMILES | NCc1cc(F)c(Oc2ccc(Br)cc2Br)c(F)c1 |
| InChI | InChI=1S/C13H9Br2F2NO/c14-8-1-2-12(9(15)5-8)19-13-10(16)3-7(6-18)4-11(13)17/h1-5H,6,18H2 |
| InChIKey | FCUNFEHSULAMTA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.03 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |