C13H7Br2FO2 — CID 64720224
4-(2,4-dibromophenoxy)-3-fluorobenzaldehyde (PubChem CID 64720224) has the molecular formula C13H7Br2FO2 and a molecular weight of 374.00 g/mol. Its IUPAC name is 4-(2,4-dibromophenoxy)-3-fluorobenzaldehyde.
| Compound Name | 4-(2,4-dibromophenoxy)-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 64720224 |
| Molecular Formula | C13H7Br2FO2 |
| Molecular Weight | 374.00 g/mol |
| Exact Mass | 371.88 |
| IUPAC Name | 4-(2,4-dibromophenoxy)-3-fluorobenzaldehyde |
| SMILES | O=Cc1ccc(Oc2ccc(Br)cc2Br)c(F)c1 |
| InChI | InChI=1S/C13H7Br2FO2/c14-9-2-4-12(10(15)6-9)18-13-3-1-8(7-17)5-11(13)16/h1-7H |
| InChIKey | NVFHJBJGXDDTFG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.00 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|