C13H6BrClF2O2 — CID 63050225
4-(2-bromo-4-chlorophenoxy)-3,5-difluorobenzaldehyde (PubChem CID 63050225) has the molecular formula C13H6BrClF2O2 and a molecular weight of 347.54 g/mol. Its IUPAC name is 4-(2-bromo-4-chlorophenoxy)-3,5-difluorobenzaldehyde.
| Compound Name | 4-(2-bromo-4-chlorophenoxy)-3,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 63050225 |
| Molecular Formula | C13H6BrClF2O2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 4-(2-bromo-4-chlorophenoxy)-3,5-difluorobenzaldehyde |
| SMILES | O=Cc1cc(F)c(Oc2ccc(Cl)cc2Br)c(F)c1 |
| InChI | InChI=1S/C13H6BrClF2O2/c14-9-5-8(15)1-2-12(9)19-13-10(16)3-7(6-18)4-11(13)17/h1-6H |
| InChIKey | ASBFWCJAUDBNHV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|