C14H11Br2ClO — CID 64720664
2,4-dibromo-1-[4-(chloromethyl)-2-methylphenoxy]benzene (PubChem CID 64720664) has the molecular formula C14H11Br2ClO and a molecular weight of 390.50 g/mol. Its IUPAC name is 2,4-dibromo-1-[4-(chloromethyl)-2-methylphenoxy]benzene.
| Compound Name | 2,4-dibromo-1-[4-(chloromethyl)-2-methylphenoxy]benzene |
|---|---|
| PubChem CID | 64720664 |
| Molecular Formula | C14H11Br2ClO |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 2,4-dibromo-1-[4-(chloromethyl)-2-methylphenoxy]benzene |
| SMILES | Cc1cc(CCl)ccc1Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2ClO/c1-9-6-10(8-17)2-4-13(9)18-14-5-3-11(15)7-12(14)16/h2-7H,8H2,1H3 |
| InChIKey | RYCHFAQRZFMRNK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|