C13H8Br2Cl2O — CID 114847129
2,4-dibromo-1-[4-chloro-2-(chloromethyl)phenoxy]benzene (PubChem CID 114847129) has the molecular formula C13H8Br2Cl2O and a molecular weight of 410.92 g/mol. Its IUPAC name is 2,4-dibromo-1-[4-chloro-2-(chloromethyl)phenoxy]benzene.
| Compound Name | 2,4-dibromo-1-[4-chloro-2-(chloromethyl)phenoxy]benzene |
|---|---|
| PubChem CID | 114847129 |
| Molecular Formula | C13H8Br2Cl2O |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 407.83 |
| IUPAC Name | 2,4-dibromo-1-[4-chloro-2-(chloromethyl)phenoxy]benzene |
| SMILES | ClCc1cc(Cl)ccc1Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H8Br2Cl2O/c14-9-1-3-13(11(15)6-9)18-12-4-2-10(17)5-8(12)7-16/h1-6H,7H2 |
| InChIKey | NLWAXDCGPTWTLU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|